ChemNet > CAS > 226396-32-3 2,3,4-Trifluorophenylboronic acid
226396-32-3 2,3,4-Trifluorophenylboronic acid
Naam product |
2,3,4-Trifluorophenylboronic acid |
MF |
C6H4BF3O2 |
Molecuulgewicht |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
CAS-nummer |
226396-32-3 |
Moleculaire Structuur |
|
Dichtheid |
1.44g/cm3 |
Smeltpunt |
229-235℃ |
Kookpunt |
260.2°C at 760 mmHg |
Brekingsindex |
1.465 |
Vlampunt |
111.2°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|